Products 1246820-93-8
CAS 1246820-93-8 appears in our catalog under these names: 1-Pyrenol-d9 Acetate, Pyren-1-yl acetate-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
(2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl) acetate (CAS 1246820-93-8) is a chemical compound with the molecular formula C18H12O2 and a molecular weight of 269.3 g/mol. IUPAC name: (2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl) acetate. InChIKey: XMAPHCGFUPXIEN-JGBJNMEESA-N.
| Molecular formula | C18H12O2 |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | (2,3,4,5,6,7,8,9,10-nonadeuteriopyren-1-yl) acetate |
| InChIKey | XMAPHCGFUPXIEN-JGBJNMEESA-N |
| SMILES | [2H]C1=C(C2=C3C(=C1[2H])C(=C(C4=C(C(=C(C(=C43)C(=C2[2H])[2H])[2H])[2H])OC(=O)C)[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
1-Pyrenol-d9 Acetate, 1-Acetoxypyrene-d9