CAS 138142-87-7 is the registry number for 1,2-Dihydroxychrysene. Offered by: TRC. Available pack sizes: 100mg.
Chrysene-1,2-diol (CAS 138142-87-7) is a chemical compound with the molecular formula C18H12O2 and a molecular weight of 260.3 g/mol. IUPAC name: chrysene-1,2-diol. InChIKey: AQHBHRWGGYLFLS-UHFFFAOYSA-N.
| Molecular formula | C18H12O2 |
|---|---|
| Molecular weight | 260.3 g/mol |
| IUPAC name | chrysene-1,2-diol |
| InChIKey | AQHBHRWGGYLFLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC(=C4O)O |
Computed by PubChem (NCBI)