Products 1246820-98-3
CAS 1246820-98-3 is the registry number for 2–(2–Amino–5–bromobenzoyl)pyridine–d4. Offered by: GLPBio. Available pack sizes: 50mg.
(2-amino-5-bromophenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methanone (CAS 1246820-98-3) is a chemical compound with the molecular formula C12H9BrN2O and a molecular weight of 281.14 g/mol. IUPAC name: (2-amino-5-bromophenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methanone. InChIKey: KHVZPFKJBLTYCC-VTBMLFEUSA-N.
| Molecular formula | C12H9BrN2O |
|---|---|
| Molecular weight | 281.14 g/mol |
| IUPAC name | (2-amino-5-bromophenyl)-(3,4,5,6-tetradeuterio-2-pyridinyl)methanone |
| InChIKey | KHVZPFKJBLTYCC-VTBMLFEUSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C(=O)C2=C(C=CC(=C2)Br)N)[2H])[2H] |
Computed by PubChem (NCBI)