Products 1246829-05-9

CAS 1246829-05-9 appears in our catalog under these names: 2,3-Dimethylpyridin-4-ylboronic acid, 95%, (2,3-Dimethylpyridin-4-yl)boronic Acid, (2,3-Dimethylpyridin-4-yl)boronic acid 97%, (2,3-Dimethylpyridin-4-yl)boronic acid, 97%, 97%, (2,3-dimethyl-4-pyridinyl)boronic acid, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g.

Structural formula: {0} (CAS {1})

(2,3-dimethyl-4-pyridinyl)boronic acid (CAS 1246829-05-9) is a chemical compound with the molecular formula C7H10BNO2 and a molecular weight of 150.97 g/mol. IUPAC name: (2,3-dimethyl-4-pyridinyl)boronic acid. InChIKey: HWCDMDXESHLLKF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO2
Molecular weight150.97 g/mol
IUPAC name(2,3-dimethyl-4-pyridinyl)boronic acid
InChIKeyHWCDMDXESHLLKF-UHFFFAOYSA-N
SMILESB(C1=C(C(=NC=C1)C)C)(O)O

Computed by PubChem (NCBI)