Products 1310384-02-1

CAS 1310384-02-1 appears in our catalog under these names: 2-Ethyl-3-pyridinylboronic acid, 95%, (2–Ethylpyridin–3–yl)boronic acid, (2-Ethylpyridin-3-yl)boronic acid 95%, 2-Ethyl-3-pyridinylboronic acid, 95% ,, 95% ,. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-ethyl-3-pyridinyl)boronic acid (CAS 1310384-02-1) is a chemical compound with the molecular formula C7H10BNO2 and a molecular weight of 150.97 g/mol. IUPAC name: (2-ethyl-3-pyridinyl)boronic acid. InChIKey: XHYBEDDNBACEEH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10BNO2
Molecular weight150.97 g/mol
IUPAC name(2-ethyl-3-pyridinyl)boronic acid
InChIKeyXHYBEDDNBACEEH-UHFFFAOYSA-N
SMILESB(C1=C(N=CC=C1)CC)(O)O

Computed by PubChem (NCBI)