Products 1246929-02-1
CAS 1246929-02-1 appears in our catalog under these names: Eltrombopag Amide, Eltrombopag Impurity 7. Offered by: Chemat Brand, Hubei YoungXin, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzamide (CAS 1246929-02-1) is a chemical compound with the molecular formula C25H23N5O3 and a molecular weight of 441.5 g/mol. IUPAC name: 3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzamide. InChIKey: DXJYXTSIEOIZHE-UHFFFAOYSA-N.
| Molecular formula | C25H23N5O3 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-[3-[[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]diazenyl]-2-hydroxyphenyl]benzamide |
| InChIKey | DXJYXTSIEOIZHE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C(=C(N2)C)N=NC3=CC=CC(=C3O)C4=CC(=CC=C4)C(=O)N)C |
Computed by PubChem (NCBI)