CAS 2031255-24-8 is the registry number for Ibrutinib Impurity 49. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 2031255-24-8) is a chemical compound with the molecular formula C25H23N5O3 and a molecular weight of 441.5 g/mol. IUPAC name: 3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: FNJXCKUZWNTECX-GOSISDBHSA-N.
| Molecular formula | C25H23N5O3 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | 3-(4-phenoxyphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | FNJXCKUZWNTECX-GOSISDBHSA-N |
| SMILES | C=CC(=O)N1CCC[C@H](C1)N2C3=C(C(=N2)C4=CC=C(C=C4)OC5=CC=CC=C5)C(=O)NC=N3 |
Computed by PubChem (NCBI)