Products 1246937-33-6
CAS 1246937-33-6 appears in our catalog under these names: Methyl dodovisate A, Methyl dodovisate A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, Get quote.
Methyl (1S,2R)-1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,4,5-tetrahydrobenzo[7]annulene-6-carboxylate (CAS 1246937-33-6) is a chemical compound with the molecular formula C21H26O3 and a molecular weight of 326.4 g/mol. IUPAC name: methyl (1S,2R)-1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,4,5-tetrahydrobenzo[7]annulene-6-carboxylate. InChIKey: CHQQKKJBNXRIGN-VFNWGFHPSA-N.
| Molecular formula | C21H26O3 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | methyl (1S,2R)-1-[2-(furan-3-yl)ethyl]-1,2-dimethyl-2,3,4,5-tetrahydrobenzo[7]annulene-6-carboxylate |
| InChIKey | CHQQKKJBNXRIGN-VFNWGFHPSA-N |
| SMILES | C[C@@H]1CCC2=C([C@@]1(C)CCC3=COC=C3)C=CC=C(C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl-Dodovisate A, orb1984178