CAS 1246964-08-8 is the registry number for AN02. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]piperidin-4-one (CAS 1246964-08-8) is a chemical compound with the molecular formula C19H15Cl2NO and a molecular weight of 344.2 g/mol. IUPAC name: (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]piperidin-4-one. InChIKey: RVBVBUPGVORCBH-KAVGSWPWSA-N.
| Molecular formula | C19H15Cl2NO |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(2-chlorophenyl)methylidene]piperidin-4-one |
| InChIKey | RVBVBUPGVORCBH-KAVGSWPWSA-N |
| SMILES | C\1NC/C(=C\C2=CC=CC=C2Cl)/C(=O)/C1=C/C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)