Products 1160257-02-2
CAS 1160257-02-2 appears in our catalog under these names: 7-Chloro-3,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride, 95%, 7-Chloro-3,8-dimethyl-2-(p-tolyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
7-chloro-3,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride (CAS 1160257-02-2) is a chemical compound with the molecular formula C19H15Cl2NO and a molecular weight of 344.2 g/mol. IUPAC name: 7-chloro-3,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride. InChIKey: NQAQZEKCJDXLFY-UHFFFAOYSA-N.
| Molecular formula | C19H15Cl2NO |
|---|---|
| Molecular weight | 344.2 g/mol |
| IUPAC name | 7-chloro-3,8-dimethyl-2-(4-methylphenyl)quinoline-4-carbonyl chloride |
| InChIKey | NQAQZEKCJDXLFY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=CC(=C3C)Cl)C(=C2C)C(=O)Cl |
Computed by PubChem (NCBI)