Products 1160256-06-3

CAS 1160256-06-3 appears in our catalog under these names: 8-Chloro-2-(4-propylphenyl)quinoline-4-carbonyl chloride, 95%, 8-Chloro-2-(4-propylphenyl)quinoline-4-carbonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

8-chloro-2-(4-propylphenyl)quinoline-4-carbonyl chloride (CAS 1160256-06-3) is a chemical compound with the molecular formula C19H15Cl2NO and a molecular weight of 344.2 g/mol. IUPAC name: 8-chloro-2-(4-propylphenyl)quinoline-4-carbonyl chloride. InChIKey: URCTZFGISUTIBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15Cl2NO
Molecular weight344.2 g/mol
IUPAC name8-chloro-2-(4-propylphenyl)quinoline-4-carbonyl chloride
InChIKeyURCTZFGISUTIBZ-UHFFFAOYSA-N
SMILESCCCC1=CC=C(C=C1)C2=NC3=C(C=CC=C3Cl)C(=C2)C(=O)Cl

Computed by PubChem (NCBI)