CAS 1247103-24-7 appears in our catalog under these names: 4-(Chloromethyl)-1-(3,4-dichlorophenyl)-1H-1,2,3-triazole, 95%, 4-(Chloromethyl)-1-(3,4-dichlorophenyl)-1H-1,2,3-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(chloromethyl)-1-(3,4-dichlorophenyl)triazole (CAS 1247103-24-7) is a chemical compound with the molecular formula C9H6Cl3N3 and a molecular weight of 262.5 g/mol. IUPAC name: 4-(chloromethyl)-1-(3,4-dichlorophenyl)triazole. InChIKey: CANHUYYJAUMSCD-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl3N3 |
|---|---|
| Molecular weight | 262.5 g/mol |
| IUPAC name | 4-(chloromethyl)-1-(3,4-dichlorophenyl)triazole |
| InChIKey | CANHUYYJAUMSCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=C(N=N2)CCl)Cl)Cl |
Computed by PubChem (NCBI)