CAS 162693-32-5 is the registry number for 3-Chloro-5-(2,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-5-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazole (CAS 162693-32-5) is a chemical compound with the molecular formula C9H6Cl3N3 and a molecular weight of 262.5 g/mol. IUPAC name: 3-chloro-5-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazole. InChIKey: WQFIFVHVWPTFBR-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl3N3 |
|---|---|
| Molecular weight | 262.5 g/mol |
| IUPAC name | 3-chloro-5-(2,4-dichlorophenyl)-4-methyl-1,2,4-triazole |
| InChIKey | WQFIFVHVWPTFBR-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1Cl)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)