CAS 1247124-72-6 is the registry number for 5-(Naphthalen-1-yl)-5,12-dihydroindolo[3,2-a]carbazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-naphthalen-1-yl-12H-indolo[3,2-c]carbazole (CAS 1247124-72-6) is a chemical compound with the molecular formula C28H18N2 and a molecular weight of 382.5 g/mol. IUPAC name: 5-naphthalen-1-yl-12H-indolo[3,2-c]carbazole. InChIKey: BHDIMXQXFUEGMT-UHFFFAOYSA-N.
| Molecular formula | C28H18N2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 5-naphthalen-1-yl-12H-indolo[3,2-c]carbazole |
| InChIKey | BHDIMXQXFUEGMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C4=C(C5=CC=CC=C53)C6=C(C=C4)C7=CC=CC=C7N6 |
Computed by PubChem (NCBI)