CAS 193699-26-2 appears in our catalog under these names: 2,3-Bis(2-naphthyl)quinoxaline, 2,3-Di(naphthalen-2-yl)quinoxaline, 97%. Offered by: Biosynth, Chemat Brand. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, on request.
2,3-dinaphthalen-2-ylquinoxaline (CAS 193699-26-2) is a chemical compound with the molecular formula C28H18N2 and a molecular weight of 382.5 g/mol. IUPAC name: 2,3-dinaphthalen-2-ylquinoxaline. InChIKey: DCERQJVUDSJYLC-UHFFFAOYSA-N.
| Molecular formula | C28H18N2 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2,3-dinaphthalen-2-ylquinoxaline |
| InChIKey | DCERQJVUDSJYLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC4=CC=CC=C4N=C3C5=CC6=CC=CC=C6C=C5 |
Computed by PubChem (NCBI)