Products 1247165-32-7
CAS 1247165-32-7 is the registry number for 3-(3-(Trifluoromethyl)-1H-pyrazol-1-yl)piperidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine (CAS 1247165-32-7) is a chemical compound with the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. IUPAC name: 3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine. InChIKey: NKMNOYDMGSWCJV-UHFFFAOYSA-N.
| Molecular formula | C9H12F3N3 |
|---|---|
| Molecular weight | 219.21 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine |
| InChIKey | NKMNOYDMGSWCJV-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)N2C=CC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)