Products 1247175-70-7
CAS 1247175-70-7 is the registry number for 2-(3-Bromothiophen-2-yl)-1-(furan-2-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-bromothiophen-2-yl)-1-(furan-2-yl)ethanone (CAS 1247175-70-7) is a chemical compound with the molecular formula C10H7BrO2S and a molecular weight of 271.13 g/mol. IUPAC name: 2-(3-bromothiophen-2-yl)-1-(furan-2-yl)ethanone. InChIKey: CHRRVDHUXFSIQS-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2S |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 2-(3-bromothiophen-2-yl)-1-(furan-2-yl)ethanone |
| InChIKey | CHRRVDHUXFSIQS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)CC2=C(C=CS2)Br |
Computed by PubChem (NCBI)