Products 2090742-87-1
CAS 2090742-87-1 is the registry number for Methyl 2-bromobenzo[b]thiophene-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-bromo-1-benzothiophene-6-carboxylate (CAS 2090742-87-1) is a chemical compound with the molecular formula C10H7BrO2S and a molecular weight of 271.13 g/mol. IUPAC name: methyl 2-bromo-1-benzothiophene-6-carboxylate. InChIKey: NOQVTGZGLZUGAZ-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2S |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | methyl 2-bromo-1-benzothiophene-6-carboxylate |
| InChIKey | NOQVTGZGLZUGAZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(S2)Br |
Computed by PubChem (NCBI)