Products 1247504-17-1
CAS 1247504-17-1 is the registry number for 2-Chloro-5-(methanesulfinylmethyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-5-(methylsulfinylmethyl)aniline (CAS 1247504-17-1) is a chemical compound with the molecular formula C8H10ClNOS and a molecular weight of 203.69 g/mol. IUPAC name: 2-chloro-5-(methylsulfinylmethyl)aniline. InChIKey: PAFVCKQHHQUIBA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNOS |
|---|---|
| Molecular weight | 203.69 g/mol |
| IUPAC name | 2-chloro-5-(methylsulfinylmethyl)aniline |
| InChIKey | PAFVCKQHHQUIBA-UHFFFAOYSA-N |
| SMILES | CS(=O)CC1=CC(=C(C=C1)Cl)N |
Computed by PubChem (NCBI)