Products 124751-37-7
CAS 124751-37-7 appears in our catalog under these names: CEV (R)-S-Oxide, >95% (HPLC), Cev (R)-S-oxide. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg.
(2S,3S,5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane] 3-oxide (CAS 124751-37-7) is a chemical compound with the molecular formula C10H17NO2S and a molecular weight of 215.31 g/mol. IUPAC name: (2S,3S,5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane] 3-oxide. InChIKey: CFUGNFXJXCPICM-BXGCZWRVSA-N.
| Molecular formula | C10H17NO2S |
|---|---|
| Molecular weight | 215.31 g/mol |
| IUPAC name | (2S,3S,5S)-2-methylspiro[1,3-oxathiolane-5,3'-1-azabicyclo[2.2.2]octane] 3-oxide |
| InChIKey | CFUGNFXJXCPICM-BXGCZWRVSA-N |
| SMILES | C[C@H]1O[C@@]2(CN3CCC2CC3)C[S@@]1=O |
Computed by PubChem (NCBI)