CAS 1932271-77-6 is the registry number for (1S,5S,7R)-10,10-Dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.0,1,5]decane-3,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(1S,5S,7R)-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (CAS 1932271-77-6) is a chemical compound with the molecular formula C10H17NO2S and a molecular weight of 215.31 g/mol. IUPAC name: (1S,5S,7R)-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide. InChIKey: DPJYJNYYDJOJNO-KHQFGBGNSA-N.
| Molecular formula | C10H17NO2S |
|---|---|
| Molecular weight | 215.31 g/mol |
| IUPAC name | (1S,5S,7R)-10,10-dimethyl-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| InChIKey | DPJYJNYYDJOJNO-KHQFGBGNSA-N |
| SMILES | CC1([C@@H]2CC[C@]13CS(=O)(=O)N[C@H]3C2)C |
Computed by PubChem (NCBI)