CAS 1247628-46-1 appears in our catalog under these names: 1-(Pyridin-2-yl)-1H-1,2,4-triazol-5-amine, 97%, 1-(Pyridin-2-yl)-1H-1,2,4-triazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-pyridin-2-yl-1,2,4-triazol-3-amine (CAS 1247628-46-1) is a chemical compound with the molecular formula C7H7N5 and a molecular weight of 161.16 g/mol. IUPAC name: 2-pyridin-2-yl-1,2,4-triazol-3-amine. InChIKey: BVMXWVUHUWOSJA-UHFFFAOYSA-N.
| Molecular formula | C7H7N5 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-pyridin-2-yl-1,2,4-triazol-3-amine |
| InChIKey | BVMXWVUHUWOSJA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C(=NC=N2)N |
Computed by PubChem (NCBI)