CAS 124763-51-5 appears in our catalog under these names: Bis-tris hydrochloride, 97%, Bis–Tris hydrochloride, BIS-TRIS hydrochloride, 98.00%, Bis-Tris HCl 97%, BIS-TRIS HYDROCHLORIDE. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 100g, 25g, 1g, 10g, 500g, 250g, 1KG.
2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol;hydrochloride (CAS 124763-51-5) is a chemical compound with the molecular formula C8H20ClNO5 and a molecular weight of 245.70 g/mol. IUPAC name: 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol;hydrochloride. InChIKey: VEYRVLHAMHQVTC-UHFFFAOYSA-N.
| Molecular formula | C8H20ClNO5 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | 2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol;hydrochloride |
| InChIKey | VEYRVLHAMHQVTC-UHFFFAOYSA-N |
| SMILES | C(CO)N(CCO)C(CO)(CO)CO.Cl |
Computed by PubChem (NCBI)