CAS 186541-49-1 is the registry number for N,N-Dimethyl-D-glucamine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10g, 1g.
(2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride (CAS 186541-49-1) is a chemical compound with the molecular formula C8H20ClNO5 and a molecular weight of 245.70 g/mol. IUPAC name: (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride. InChIKey: LQHDEGQXAYWMIZ-ANJNCBFHSA-N.
| Molecular formula | C8H20ClNO5 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | (2R,3R,4R,5S)-6-(dimethylamino)hexane-1,2,3,4,5-pentol;hydrochloride |
| InChIKey | LQHDEGQXAYWMIZ-ANJNCBFHSA-N |
| SMILES | CN(C)C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O.Cl |
Computed by PubChem (NCBI)