Products 1247805-05-5
CAS 1247805-05-5 is the registry number for 3-(5-Fluoropyridin-3-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(5-fluoro-3-pyridinyl)benzoic acid (CAS 1247805-05-5) is a chemical compound with the molecular formula C12H8FNO2 and a molecular weight of 217.20 g/mol. IUPAC name: 3-(5-fluoro-3-pyridinyl)benzoic acid. InChIKey: BLRAPXLSPIBVHM-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2 |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 3-(5-fluoro-3-pyridinyl)benzoic acid |
| InChIKey | BLRAPXLSPIBVHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC(=CN=C2)F |
Computed by PubChem (NCBI)