CAS 928658-24-6 appears in our catalog under these names: 4-(6-Fluoro-3-pyridinyl)benzoic acid, 95%, 4-(6-Fluoropyridin-3-yl)benzoic acid, 98%, 4-(6-Fluoro-3-pyridinyl)benzoic acid, ≥95%, ≥95%, 4-(6-Fluoro-3-pyridinyl)benzoic acid, >=95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
4-(6-fluoro-3-pyridinyl)benzoic acid (CAS 928658-24-6) is a chemical compound with the molecular formula C12H8FNO2 and a molecular weight of 217.20 g/mol. IUPAC name: 4-(6-fluoro-3-pyridinyl)benzoic acid. InChIKey: BQTCYQOJIFTDLE-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO2 |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 4-(6-fluoro-3-pyridinyl)benzoic acid |
| InChIKey | BQTCYQOJIFTDLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)