CAS 124782-95-2 appears in our catalog under these names: 6–bromo–2–(piperazin–1–yl)quinoline, 6-Bromo-2-piperazin-1-yl-quinoline, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
6-bromo-2-piperazin-1-ylquinoline (CAS 124782-95-2) is a chemical compound with the molecular formula C13H14BrN3 and a molecular weight of 292.17 g/mol. IUPAC name: 6-bromo-2-piperazin-1-ylquinoline. InChIKey: MKIHFWMBAKJYJL-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3 |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | 6-bromo-2-piperazin-1-ylquinoline |
| InChIKey | MKIHFWMBAKJYJL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)