CAS 1423037-54-0 is the registry number for 7-Bromo-1-butyl-2-methyl-1,3-benzodiazole-5-carbonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
7-bromo-1-butyl-2-methylbenzimidazole-5-carbonitrile (CAS 1423037-54-0) is a chemical compound with the molecular formula C13H14BrN3 and a molecular weight of 292.17 g/mol. IUPAC name: 7-bromo-1-butyl-2-methylbenzimidazole-5-carbonitrile. InChIKey: MGRNNFSGHAUAKS-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3 |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | 7-bromo-1-butyl-2-methylbenzimidazole-5-carbonitrile |
| InChIKey | MGRNNFSGHAUAKS-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=NC2=C1C(=CC(=C2)C#N)Br)C |
Computed by PubChem (NCBI)