CAS 1247829-97-5 appears in our catalog under these names: 3-Methyl-3-(thiophen-3-yl)pyrrolidine-2,5-dione, 95%, 3-Methyl-3-(thiophen-3-yl)pyrrolidine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-methyl-3-thiophen-3-ylpyrrolidine-2,5-dione (CAS 1247829-97-5) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 3-methyl-3-thiophen-3-ylpyrrolidine-2,5-dione. InChIKey: HEVKOJSKGLAFLE-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 3-methyl-3-thiophen-3-ylpyrrolidine-2,5-dione |
| InChIKey | HEVKOJSKGLAFLE-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC1=O)C2=CSC=C2 |
Computed by PubChem (NCBI)