CAS 124790-90-5 is the registry number for 1-Phenyl-N'-(phenylmethane)sulfonylmethanesulfonohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N'-benzylsulfonyl-1-phenylmethanesulfonohydrazide (CAS 124790-90-5) is a chemical compound with the molecular formula C14H16N2O4S2 and a molecular weight of 340.4 g/mol. IUPAC name: N'-benzylsulfonyl-1-phenylmethanesulfonohydrazide. InChIKey: FRIMORPKJDYPDB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4S2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | N'-benzylsulfonyl-1-phenylmethanesulfonohydrazide |
| InChIKey | FRIMORPKJDYPDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)NNS(=O)(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)