Products 36041-93-7
CAS 36041-93-7 appears in our catalog under these names: Ticarcillin EP Impurity A, Ticarcillin Sodium EP Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-thiophen-3-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 36041-93-7) is a chemical compound with the molecular formula C14H16N2O4S2 and a molecular weight of 340.4 g/mol. IUPAC name: (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-thiophen-3-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: YSQNZHBPPHVMSD-JFGNBEQYSA-N.
| Molecular formula | C14H16N2O4S2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-thiophen-3-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | YSQNZHBPPHVMSD-JFGNBEQYSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CSC=C3)C(=O)O)C |
Computed by PubChem (NCBI)