Products 1247926-57-3

CAS 1247926-57-3 is the registry number for Ethyl N-(2-amino-1-cyclopropylethyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl N-(2-amino-1-cyclopropylethyl)carbamate (CAS 1247926-57-3) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: ethyl N-(2-amino-1-cyclopropylethyl)carbamate. InChIKey: LXAQQDNQIQVNMW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O2
Molecular weight172.22 g/mol
IUPAC nameethyl N-(2-amino-1-cyclopropylethyl)carbamate
InChIKeyLXAQQDNQIQVNMW-UHFFFAOYSA-N
SMILESCCOC(=O)NC(CN)C1CC1

Computed by PubChem (NCBI)