Products 1248271-71-7
CAS 1248271-71-7 is the registry number for Flumazenil Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-amino-5-fluorobenzoyl)-methylamino]acetic acid (CAS 1248271-71-7) is a chemical compound with the molecular formula C10H11FN2O3 and a molecular weight of 226.20 g/mol. IUPAC name: 2-[(2-amino-5-fluorobenzoyl)-methylamino]acetic acid. InChIKey: UMWIATIFLVZJBM-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O3 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 2-[(2-amino-5-fluorobenzoyl)-methylamino]acetic acid |
| InChIKey | UMWIATIFLVZJBM-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)C1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)