Products 1248307-38-1
CAS 1248307-38-1 is the registry number for 2-Azido-1-(pyrrolidin-1-yl)propan-1-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-azido-1-pyrrolidin-1-ylpropan-1-one (CAS 1248307-38-1) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: 2-azido-1-pyrrolidin-1-ylpropan-1-one. InChIKey: QORIDZQVZUVVRX-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | 2-azido-1-pyrrolidin-1-ylpropan-1-one |
| InChIKey | QORIDZQVZUVVRX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCCC1)N=[N+]=[N-] |
Computed by PubChem (NCBI)