Products 1248446-81-2
CAS 1248446-81-2 is the registry number for 2-(4-Bromo-1H-pyrazol-1-yl)-N-(tert-pentyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromopyrazol-1-yl)-N-(2-methylbutan-2-yl)acetamide (CAS 1248446-81-2) is a chemical compound with the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. IUPAC name: 2-(4-bromopyrazol-1-yl)-N-(2-methylbutan-2-yl)acetamide. InChIKey: CLJHSFFVULPTMX-UHFFFAOYSA-N.
| Molecular formula | C10H16BrN3O |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 2-(4-bromopyrazol-1-yl)-N-(2-methylbutan-2-yl)acetamide |
| InChIKey | CLJHSFFVULPTMX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NC(=O)CN1C=C(C=N1)Br |
Computed by PubChem (NCBI)