Products 1355927-56-8
CAS 1355927-56-8 is the registry number for 1-((5-Bromopyrimidin-2-yl)amino)-3,3-dimethylbutan-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-bromopyrimidin-2-yl)amino]-3,3-dimethylbutan-2-ol (CAS 1355927-56-8) is a chemical compound with the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. IUPAC name: 1-[(5-bromopyrimidin-2-yl)amino]-3,3-dimethylbutan-2-ol. InChIKey: KAPUNZKMZVYTEA-UHFFFAOYSA-N.
| Molecular formula | C10H16BrN3O |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 1-[(5-bromopyrimidin-2-yl)amino]-3,3-dimethylbutan-2-ol |
| InChIKey | KAPUNZKMZVYTEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CNC1=NC=C(C=N1)Br)O |
Computed by PubChem (NCBI)