Products 1248595-17-6
CAS 1248595-17-6 is the registry number for 5-(5-Methyl-1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(5-methyl-1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine (CAS 1248595-17-6) is a chemical compound with the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. IUPAC name: 5-(5-methyl-1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine. InChIKey: KWGGULMXNRMPRU-UHFFFAOYSA-N.
| Molecular formula | C11H9N3OS |
|---|---|
| Molecular weight | 231.28 g/mol |
| IUPAC name | 5-(5-methyl-1-benzofuran-2-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | KWGGULMXNRMPRU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=C2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)