CAS 17304-62-0 is the registry number for 1-(Benzo[d]thiazol-2-yl)-3-methyl-1H-pyrazol-5(4H)-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzothiazol-2-yl)-5-methyl-4H-pyrazol-3-one (CAS 17304-62-0) is a chemical compound with the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-5-methyl-4H-pyrazol-3-one. InChIKey: YUHMNVVMEMQSHG-UHFFFAOYSA-N.
| Molecular formula | C11H9N3OS |
|---|---|
| Molecular weight | 231.28 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-5-methyl-4H-pyrazol-3-one |
| InChIKey | YUHMNVVMEMQSHG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)