CAS 1248786-62-0 is the registry number for 3,4-Dichloro-α-methyl-α-(1-methylethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2-(3,4-dichlorophenyl)-3-methylbutan-2-ol (CAS 1248786-62-0) is a chemical compound with the molecular formula C11H14Cl2O and a molecular weight of 233.13 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-3-methylbutan-2-ol. InChIKey: IPNXDDSSVFLLNX-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2O |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-3-methylbutan-2-ol |
| InChIKey | IPNXDDSSVFLLNX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)