Products 1488145-61-4
CAS 1488145-61-4 is the registry number for 1-(3,5-dichlorophenyl)-2,2-dimethylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-dichlorophenyl)-2,2-dimethylpropan-1-ol (CAS 1488145-61-4) is a chemical compound with the molecular formula C11H14Cl2O and a molecular weight of 233.13 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)-2,2-dimethylpropan-1-ol. InChIKey: ROHLUJDWBUEZLI-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2O |
|---|---|
| Molecular weight | 233.13 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)-2,2-dimethylpropan-1-ol |
| InChIKey | ROHLUJDWBUEZLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)