CAS 124886-01-7 is the registry number for BMY 20844. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one (CAS 124886-01-7) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: 7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one. InChIKey: ODCKPUDNMNCWMR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| InChIKey | ODCKPUDNMNCWMR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC3=C(NC(=O)N3)N=C2C=C1)C |
Computed by PubChem (NCBI)