CAS 1248914-99-9 is the registry number for 5-Bromo-2-chloro-n,n-diethyl-nicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-chloro-N,N-diethylpyridine-3-carboxamide (CAS 1248914-99-9) is a chemical compound with the molecular formula C10H12BrClN2O and a molecular weight of 291.57 g/mol. IUPAC name: 5-bromo-2-chloro-N,N-diethylpyridine-3-carboxamide. InChIKey: KOAMTFPLRNXVOL-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | 5-bromo-2-chloro-N,N-diethylpyridine-3-carboxamide |
| InChIKey | KOAMTFPLRNXVOL-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(N=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)