CAS 215649-81-3 is the registry number for 1-(3-Bromophenyl)-piperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-bromophenyl)piperazin-2-one;hydrochloride (CAS 215649-81-3) is a chemical compound with the molecular formula C10H12BrClN2O and a molecular weight of 291.57 g/mol. IUPAC name: 1-(3-bromophenyl)piperazin-2-one;hydrochloride. InChIKey: ALZPDFZMDRHYQL-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClN2O |
|---|---|
| Molecular weight | 291.57 g/mol |
| IUPAC name | 1-(3-bromophenyl)piperazin-2-one;hydrochloride |
| InChIKey | ALZPDFZMDRHYQL-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)