Products 1248935-11-6
CAS 1248935-11-6 is the registry number for 3,5-dimethyl-1-(pentan-3-yl)-1H-pyrazol-4-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,5-dimethyl-1-pentan-3-ylpyrazol-4-amine (CAS 1248935-11-6) is a chemical compound with the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. IUPAC name: 3,5-dimethyl-1-pentan-3-ylpyrazol-4-amine. InChIKey: NXOJKXFZRWOYEP-UHFFFAOYSA-N.
| Molecular formula | C10H19N3 |
|---|---|
| Molecular weight | 181.28 g/mol |
| IUPAC name | 3,5-dimethyl-1-pentan-3-ylpyrazol-4-amine |
| InChIKey | NXOJKXFZRWOYEP-UHFFFAOYSA-N |
| SMILES | CCC(CC)N1C(=C(C(=N1)C)N)C |
Computed by PubChem (NCBI)