CAS 1249036-43-8 is the registry number for 2,2,2-Trifluoro-1-(4-(propan-2-yloxy)phenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanol (CAS 1249036-43-8) is a chemical compound with the molecular formula C11H13F3O2 and a molecular weight of 234.21 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanol. InChIKey: FTKMGZZNKSHVBG-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O2 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-propan-2-yloxyphenyl)ethanol |
| InChIKey | FTKMGZZNKSHVBG-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)