CAS 1249088-63-8 is the registry number for (1-(3-Chloro-4-fluorophenyl)-1H-1,2,3-triazol-4-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[1-(3-chloro-4-fluorophenyl)triazol-4-yl]methanol (CAS 1249088-63-8) is a chemical compound with the molecular formula C9H7ClFN3O and a molecular weight of 227.62 g/mol. IUPAC name: [1-(3-chloro-4-fluorophenyl)triazol-4-yl]methanol. InChIKey: BNYDDEHPEVTDRB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN3O |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | [1-(3-chloro-4-fluorophenyl)triazol-4-yl]methanol |
| InChIKey | BNYDDEHPEVTDRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=C(N=N2)CO)Cl)F |
Computed by PubChem (NCBI)