CAS 937665-82-2 is the registry number for (3-(2-Chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine (CAS 937665-82-2) is a chemical compound with the molecular formula C9H7ClFN3O and a molecular weight of 227.62 g/mol. IUPAC name: [3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine. InChIKey: QBKVFPGEXAIBLY-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN3O |
|---|---|
| Molecular weight | 227.62 g/mol |
| IUPAC name | [3-(2-chloro-6-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| InChIKey | QBKVFPGEXAIBLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=NOC(=N2)CN)F |
Computed by PubChem (NCBI)