CAS 1249142-99-1 appears in our catalog under these names: 3-(3-Fluorophenyl)-2,2-dimethylpyrrolidine, 95%, 3-(3-Fluorophenyl)-2,2-dimethylpyrrolidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 50mg, 0,5g.
3-(3-fluorophenyl)-2,2-dimethylpyrrolidine (CAS 1249142-99-1) is a chemical compound with the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. IUPAC name: 3-(3-fluorophenyl)-2,2-dimethylpyrrolidine. InChIKey: HIPUXUJIBUVACT-UHFFFAOYSA-N.
| Molecular formula | C12H16FN |
|---|---|
| Molecular weight | 193.26 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-2,2-dimethylpyrrolidine |
| InChIKey | HIPUXUJIBUVACT-UHFFFAOYSA-N |
| SMILES | CC1(C(CCN1)C2=CC(=CC=C2)F)C |
Computed by PubChem (NCBI)