Products 124927-89-5
CAS 124927-89-5 is the registry number for (9H-Fluoren-9-yl)methyl 2-aminoacetate, trifluoroacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
9H-fluoren-9-ylmethyl 2-aminoacetate;2,2,2-trifluoroacetic acid (CAS 124927-89-5) is a chemical compound with the molecular formula C18H16F3NO4 and a molecular weight of 367.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 2-aminoacetate;2,2,2-trifluoroacetic acid. InChIKey: ZBYYMDXGHPDFIX-UHFFFAOYSA-N.
| Molecular formula | C18H16F3NO4 |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 2-aminoacetate;2,2,2-trifluoroacetic acid |
| InChIKey | ZBYYMDXGHPDFIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)