CAS 1249324-60-4 appears in our catalog under these names: 1-(3-Bromopyridin-2-yl)-1H-1,2,4-triazol-3-amine, 95%, 1-(3-Bromopyridin-2-yl)-1H-1,2,4-triazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(3-bromo-2-pyridinyl)-1,2,4-triazol-3-amine (CAS 1249324-60-4) is a chemical compound with the molecular formula C7H6BrN5 and a molecular weight of 240.06 g/mol. IUPAC name: 1-(3-bromo-2-pyridinyl)-1,2,4-triazol-3-amine. InChIKey: VEDQKDFKHDYJKV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrN5 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 1-(3-bromo-2-pyridinyl)-1,2,4-triazol-3-amine |
| InChIKey | VEDQKDFKHDYJKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=NC(=N2)N)Br |
Computed by PubChem (NCBI)